C13H11NO4 — CID 114028461
4-but-3-ynoyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (PubChem CID 114028461) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is 4-but-3-ynoyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid.
| Compound Name | 4-but-3-ynoyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
|---|---|
| PubChem CID | 114028461 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 4-but-3-ynoyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| SMILES | C#CCC(=O)N1CC(C(=O)O)Oc2ccccc21 |
| InChI | InChI=1S/C13H11NO4/c1-2-5-12(15)14-8-11(13(16)17)18-10-7-4-3-6-9(10)14/h1,3-4,6-7,11H,5,8H2,(H,16,17) |
| InChIKey | LPDPABZBEAQSLA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|