C15H20N2O4 — CID 82850277
4-(5-aminohexanoyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (PubChem CID 82850277) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is 4-(5-aminohexanoyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid.
| Compound Name | 4-(5-aminohexanoyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
|---|---|
| PubChem CID | 82850277 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 4-(5-aminohexanoyl)-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| SMILES | CC(N)CCCC(=O)N1CC(C(=O)O)Oc2ccccc21 |
| InChI | InChI=1S/C15H20N2O4/c1-10(16)5-4-8-14(18)17-9-13(15(19)20)21-12-7-3-2-6-11(12)17/h2-3,6-7,10,13H,4-5,8-9,16H2,1H3,(H,19,20) |
| InChIKey | CYSZXRXNSUGLSI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |