C15H10FIO2 — CID 114029198
1,3-dihydro-2-benzofuran-5-yl-(4-fluoro-2-iodophenyl)methanone (PubChem CID 114029198) has the molecular formula C15H10FIO2 and a molecular weight of 368.15 g/mol. Its IUPAC name is 1,3-dihydro-2-benzofuran-5-yl-(4-fluoro-2-iodophenyl)methanone.
| Compound Name | 1,3-dihydro-2-benzofuran-5-yl-(4-fluoro-2-iodophenyl)methanone |
|---|---|
| PubChem CID | 114029198 |
| Molecular Formula | C15H10FIO2 |
| Molecular Weight | 368.15 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | 1,3-dihydro-2-benzofuran-5-yl-(4-fluoro-2-iodophenyl)methanone |
| SMILES | O=C(c1ccc2c(c1)COC2)c1ccc(F)cc1I |
| InChI | InChI=1S/C15H10FIO2/c16-12-3-4-13(14(17)6-12)15(18)9-1-2-10-7-19-8-11(10)5-9/h1-6H,7-8H2 |
| InChIKey | MEYAPACHGBMHFC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.15 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|