C15H11F2IO — CID 114029200
(4-fluoro-3,5-dimethylphenyl)-(4-fluoro-2-iodophenyl)methanone (PubChem CID 114029200) has the molecular formula C15H11F2IO and a molecular weight of 372.15 g/mol. Its IUPAC name is (4-fluoro-3,5-dimethylphenyl)-(4-fluoro-2-iodophenyl)methanone.
| Compound Name | (4-fluoro-3,5-dimethylphenyl)-(4-fluoro-2-iodophenyl)methanone |
|---|---|
| PubChem CID | 114029200 |
| Molecular Formula | C15H11F2IO |
| Molecular Weight | 372.15 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | (4-fluoro-3,5-dimethylphenyl)-(4-fluoro-2-iodophenyl)methanone |
| SMILES | Cc1cc(C(=O)c2ccc(F)cc2I)cc(C)c1F |
| InChI | InChI=1S/C15H11F2IO/c1-8-5-10(6-9(2)14(8)17)15(19)12-4-3-11(16)7-13(12)18/h3-7H,1-2H3 |
| InChIKey | BANWUSFJXGGWHH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.15 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|