C15H14FIN2O — CID 78874285
4-fluoro-2-iodo-N-(2,4,6-trimethyl-3-pyridinyl)benzamide (PubChem CID 78874285) has the molecular formula C15H14FIN2O and a molecular weight of 384.19 g/mol. Its IUPAC name is 4-fluoro-2-iodo-N-(2,4,6-trimethyl-3-pyridinyl)benzamide.
| Compound Name | 4-fluoro-2-iodo-N-(2,4,6-trimethyl-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 78874285 |
| Molecular Formula | C15H14FIN2O |
| Molecular Weight | 384.19 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 4-fluoro-2-iodo-N-(2,4,6-trimethyl-3-pyridinyl)benzamide |
| SMILES | Cc1cc(C)c(NC(=O)c2ccc(F)cc2I)c(C)n1 |
| InChI | InChI=1S/C15H14FIN2O/c1-8-6-9(2)18-10(3)14(8)19-15(20)12-5-4-11(16)7-13(12)17/h4-7H,1-3H3,(H,19,20) |
| InChIKey | BGUZHXPYZBRHNO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.19 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|