C14H22FIN2 — CID 114029256
N-tert-butyl-N'-[(4-fluoro-2-iodophenyl)methyl]-N'-methylethane-1,2-diamine (PubChem CID 114029256) has the molecular formula C14H22FIN2 and a molecular weight of 364.25 g/mol. Its IUPAC name is N-tert-butyl-N'-[(4-fluoro-2-iodophenyl)methyl]-N'-methylethane-1,2-diamine.
| Compound Name | N-tert-butyl-N'-[(4-fluoro-2-iodophenyl)methyl]-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 114029256 |
| Molecular Formula | C14H22FIN2 |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | N-tert-butyl-N'-[(4-fluoro-2-iodophenyl)methyl]-N'-methylethane-1,2-diamine |
| SMILES | CN(CCNC(C)(C)C)Cc1ccc(F)cc1I |
| InChI | InChI=1S/C14H22FIN2/c1-14(2,3)17-7-8-18(4)10-11-5-6-12(15)9-13(11)16/h5-6,9,17H,7-8,10H2,1-4H3 |
| InChIKey | YUHKOKZGPVVIOL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|