C12H11F4N3S — CID 114031846
[[3-fluoro-4-(trifluoromethyl)phenyl]-(2-methyl-1,3-thiazol-5-yl)methyl]hydrazine (PubChem CID 114031846) has the molecular formula C12H11F4N3S and a molecular weight of 305.30 g/mol. Its IUPAC name is [[3-fluoro-4-(trifluoromethyl)phenyl]-(2-methyl-1,3-thiazol-5-yl)methyl]hydrazine.
| Compound Name | [[3-fluoro-4-(trifluoromethyl)phenyl]-(2-methyl-1,3-thiazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 114031846 |
| Molecular Formula | C12H11F4N3S |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | [[3-fluoro-4-(trifluoromethyl)phenyl]-(2-methyl-1,3-thiazol-5-yl)methyl]hydrazine |
| SMILES | Cc1ncc(C(NN)c2ccc(C(F)(F)F)c(F)c2)s1 |
| InChI | InChI=1S/C12H11F4N3S/c1-6-18-5-10(20-6)11(19-17)7-2-3-8(9(13)4-7)12(14,15)16/h2-5,11,19H,17H2,1H3 |
| InChIKey | ZWODIJPPSMKFOM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|