C10H8F4N4S — CID 107292527
[[3-fluoro-4-(trifluoromethyl)phenyl]-(thiadiazol-5-yl)methyl]hydrazine (PubChem CID 107292527) has the molecular formula C10H8F4N4S and a molecular weight of 292.26 g/mol. Its IUPAC name is [[3-fluoro-4-(trifluoromethyl)phenyl]-(thiadiazol-5-yl)methyl]hydrazine.
| Compound Name | [[3-fluoro-4-(trifluoromethyl)phenyl]-(thiadiazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107292527 |
| Molecular Formula | C10H8F4N4S |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | [[3-fluoro-4-(trifluoromethyl)phenyl]-(thiadiazol-5-yl)methyl]hydrazine |
| SMILES | NNC(c1ccc(C(F)(F)F)c(F)c1)c1cnns1 |
| InChI | InChI=1S/C10H8F4N4S/c11-7-3-5(1-2-6(7)10(12,13)14)9(17-15)8-4-16-18-19-8/h1-4,9,17H,15H2 |
| InChIKey | ZBMIFYVNGPPOMR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|