C10H10F2N4S — CID 105330178
[(2,6-difluoro-3-methylphenyl)-(thiadiazol-5-yl)methyl]hydrazine (PubChem CID 105330178) has the molecular formula C10H10F2N4S and a molecular weight of 256.28 g/mol. Its IUPAC name is [(2,6-difluoro-3-methylphenyl)-(thiadiazol-5-yl)methyl]hydrazine.
| Compound Name | [(2,6-difluoro-3-methylphenyl)-(thiadiazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105330178 |
| Molecular Formula | C10H10F2N4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | [(2,6-difluoro-3-methylphenyl)-(thiadiazol-5-yl)methyl]hydrazine |
| SMILES | Cc1ccc(F)c(C(NN)c2cnns2)c1F |
| InChI | InChI=1S/C10H10F2N4S/c1-5-2-3-6(11)8(9(5)12)10(15-13)7-4-14-16-17-7/h2-4,10,15H,13H2,1H3 |
| InChIKey | NHYORVXAJSWILB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|