C12H15F2N5 — CID 114213669
[(2,6-difluoro-3-methylphenyl)-(3-ethyltriazol-4-yl)methyl]hydrazine (PubChem CID 114213669) has the molecular formula C12H15F2N5 and a molecular weight of 267.28 g/mol. Its IUPAC name is [(2,6-difluoro-3-methylphenyl)-(3-ethyltriazol-4-yl)methyl]hydrazine.
| Compound Name | [(2,6-difluoro-3-methylphenyl)-(3-ethyltriazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 114213669 |
| Molecular Formula | C12H15F2N5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | [(2,6-difluoro-3-methylphenyl)-(3-ethyltriazol-4-yl)methyl]hydrazine |
| SMILES | CCn1nncc1C(NN)c1c(F)ccc(C)c1F |
| InChI | InChI=1S/C12H15F2N5/c1-3-19-9(6-16-18-19)12(17-15)10-8(13)5-4-7(2)11(10)14/h4-6,12,17H,3,15H2,1-2H3 |
| InChIKey | XBBHZQCKPPWQQN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|