C12H21N7 — CID 114213661
[(1,3-diethylpyrazol-5-yl)-(3-ethyltriazol-4-yl)methyl]hydrazine (PubChem CID 114213661) has the molecular formula C12H21N7 and a molecular weight of 263.35 g/mol. Its IUPAC name is [(1,3-diethylpyrazol-5-yl)-(3-ethyltriazol-4-yl)methyl]hydrazine.
| Compound Name | [(1,3-diethylpyrazol-5-yl)-(3-ethyltriazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 114213661 |
| Molecular Formula | C12H21N7 |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | [(1,3-diethylpyrazol-5-yl)-(3-ethyltriazol-4-yl)methyl]hydrazine |
| SMILES | CCc1cc(C(NN)c2cnnn2CC)n(CC)n1 |
| InChI | InChI=1S/C12H21N7/c1-4-9-7-10(18(5-2)16-9)12(15-13)11-8-14-17-19(11)6-3/h7-8,12,15H,4-6,13H2,1-3H3 |
| InChIKey | QEAUBSHLIMMWMY-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|