C10H18N4 — CID 105318016
1-(1,3-diethylpyrazol-5-yl)prop-2-enylhydrazine (PubChem CID 105318016) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-(1,3-diethylpyrazol-5-yl)prop-2-enylhydrazine.
| Compound Name | 1-(1,3-diethylpyrazol-5-yl)prop-2-enylhydrazine |
|---|---|
| PubChem CID | 105318016 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1-(1,3-diethylpyrazol-5-yl)prop-2-enylhydrazine |
| SMILES | C=CC(NN)c1cc(CC)nn1CC |
| InChI | InChI=1S/C10H18N4/c1-4-8-7-10(9(5-2)12-11)14(6-3)13-8/h5,7,9,12H,2,4,6,11H2,1,3H3 |
| InChIKey | UDWWDFIQUPBAOZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|