C11H19N7 — CID 105337585
[(1,3-diethylpyrazol-5-yl)-(3-methyltriazol-4-yl)methyl]hydrazine (PubChem CID 105337585) has the molecular formula C11H19N7 and a molecular weight of 249.32 g/mol. Its IUPAC name is [(1,3-diethylpyrazol-5-yl)-(3-methyltriazol-4-yl)methyl]hydrazine.
| Compound Name | [(1,3-diethylpyrazol-5-yl)-(3-methyltriazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105337585 |
| Molecular Formula | C11H19N7 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | [(1,3-diethylpyrazol-5-yl)-(3-methyltriazol-4-yl)methyl]hydrazine |
| SMILES | CCc1cc(C(NN)c2cnnn2C)n(CC)n1 |
| InChI | InChI=1S/C11H19N7/c1-4-8-6-9(18(5-2)15-8)11(14-12)10-7-13-16-17(10)3/h6-7,11,14H,4-5,12H2,1-3H3 |
| InChIKey | AODCGQDSLHHBAG-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|