C13H12BrIN2O — CID 114032303
N-[[5-(5-bromo-2-iodophenyl)-1,3-oxazol-4-yl]methyl]cyclopropanamine (PubChem CID 114032303) has the molecular formula C13H12BrIN2O and a molecular weight of 419.06 g/mol. Its IUPAC name is N-[[5-(5-bromo-2-iodophenyl)-1,3-oxazol-4-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-(5-bromo-2-iodophenyl)-1,3-oxazol-4-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 114032303 |
| Molecular Formula | C13H12BrIN2O |
| Molecular Weight | 419.06 g/mol |
| Exact Mass | 417.92 |
| IUPAC Name | N-[[5-(5-bromo-2-iodophenyl)-1,3-oxazol-4-yl]methyl]cyclopropanamine |
| SMILES | Brc1ccc(I)c(-c2ocnc2CNC2CC2)c1 |
| InChI | InChI=1S/C13H12BrIN2O/c14-8-1-4-11(15)10(5-8)13-12(17-7-18-13)6-16-9-2-3-9/h1,4-5,7,9,16H,2-3,6H2 |
| InChIKey | CVXJDMAZMXGBJI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.06 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|