C11H11IN2OS — CID 79690662
N-[[5-(5-iodothiophen-3-yl)-1,3-oxazol-4-yl]methyl]cyclopropanamine (PubChem CID 79690662) has the molecular formula C11H11IN2OS and a molecular weight of 346.19 g/mol. Its IUPAC name is N-[[5-(5-iodothiophen-3-yl)-1,3-oxazol-4-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-(5-iodothiophen-3-yl)-1,3-oxazol-4-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 79690662 |
| Molecular Formula | C11H11IN2OS |
| Molecular Weight | 346.19 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | N-[[5-(5-iodothiophen-3-yl)-1,3-oxazol-4-yl]methyl]cyclopropanamine |
| SMILES | Ic1cc(-c2ocnc2CNC2CC2)cs1 |
| InChI | InChI=1S/C11H11IN2OS/c12-10-3-7(5-16-10)11-9(14-6-15-11)4-13-8-1-2-8/h3,5-6,8,13H,1-2,4H2 |
| InChIKey | SFKXAUFFTZHIJX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.19 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|