C9H14F4N2O2 — CID 114032641
2,2,3,3-tetrafluoro-1-[2-(methylaminomethyl)morpholin-4-yl]propan-1-one (PubChem CID 114032641) has the molecular formula C9H14F4N2O2 and a molecular weight of 258.21 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-1-[2-(methylaminomethyl)morpholin-4-yl]propan-1-one.
| Compound Name | 2,2,3,3-tetrafluoro-1-[2-(methylaminomethyl)morpholin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 114032641 |
| Molecular Formula | C9H14F4N2O2 |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2,2,3,3-tetrafluoro-1-[2-(methylaminomethyl)morpholin-4-yl]propan-1-one |
| SMILES | CNCC1CN(C(=O)C(F)(F)C(F)F)CCO1 |
| InChI | InChI=1S/C9H14F4N2O2/c1-14-4-6-5-15(2-3-17-6)8(16)9(12,13)7(10)11/h6-7,14H,2-5H2,1H3 |
| InChIKey | RPIXABXXFHPQRY-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|