C11H21NO5S — CID 11403338
tert-butyl 4-methylsulfonyloxy(2,6-14C2)azinane-1-carboxylate (PubChem CID 11403338) has the molecular formula C11H21NO5S and a molecular weight of 283.34 g/mol. Its IUPAC name is tert-butyl 4-methylsulfonyloxy(2,6-14C2)azinane-1-carboxylate.
| Compound Name | tert-butyl 4-methylsulfonyloxy(2,6-14C2)azinane-1-carboxylate |
|---|---|
| PubChem CID | 11403338 |
| Molecular Formula | C11H21NO5S |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | tert-butyl 4-methylsulfonyloxy(2,6-14C2)azinane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[14CH2]CC(OS(C)(=O)=O)C[14CH2]1 |
| InChI | InChI=1S/C11H21NO5S/c1-11(2,3)16-10(13)12-7-5-9(6-8-12)17-18(4,14)15/h9H,5-8H2,1-4H3/i7+2,8+2 |
| InChIKey | WOEQSXAIPTXOPY-SHGRYJKJSA-N |
| XLogP | 1.36 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|