C10H11N3O4S — CID 114033391
1-[5-(5-nitrothiophen-2-yl)-1,2,4-oxadiazol-3-yl]butan-1-ol (PubChem CID 114033391) has the molecular formula C10H11N3O4S and a molecular weight of 269.28 g/mol. Its IUPAC name is 1-[5-(5-nitrothiophen-2-yl)-1,2,4-oxadiazol-3-yl]butan-1-ol.
| Compound Name | 1-[5-(5-nitrothiophen-2-yl)-1,2,4-oxadiazol-3-yl]butan-1-ol |
|---|---|
| PubChem CID | 114033391 |
| Molecular Formula | C10H11N3O4S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 1-[5-(5-nitrothiophen-2-yl)-1,2,4-oxadiazol-3-yl]butan-1-ol |
| SMILES | CCCC(O)c1noc(-c2ccc([N+](=O)[O-])s2)n1 |
| InChI | InChI=1S/C10H11N3O4S/c1-2-3-6(14)9-11-10(17-12-9)7-4-5-8(18-7)13(15)16/h4-6,14H,2-3H2,1H3 |
| InChIKey | XQUCNYUKDNNENJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|