C11H10ClFN4O — CID 114034294
2-chloro-5-fluoro-N-[2-(1H-imidazol-2-yl)ethyl]pyridine-3-carboxamide (PubChem CID 114034294) has the molecular formula C11H10ClFN4O and a molecular weight of 268.68 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-[2-(1H-imidazol-2-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-5-fluoro-N-[2-(1H-imidazol-2-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 114034294 |
| Molecular Formula | C11H10ClFN4O |
| Molecular Weight | 268.68 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-chloro-5-fluoro-N-[2-(1H-imidazol-2-yl)ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCc1ncc[nH]1)c1cc(F)cnc1Cl |
| InChI | InChI=1S/C11H10ClFN4O/c12-10-8(5-7(13)6-17-10)11(18)16-2-1-9-14-3-4-15-9/h3-6H,1-2H2,(H,14,15)(H,16,18) |
| InChIKey | VCHOIRDADRSHKX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.68 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|