C12H15FN4O — CID 114035010
N-(1-cyanopropan-2-yl)-5-fluoro-N-methyl-2-(methylamino)pyridine-3-carboxamide (PubChem CID 114035010) has the molecular formula C12H15FN4O and a molecular weight of 250.28 g/mol. Its IUPAC name is N-(1-cyanopropan-2-yl)-5-fluoro-N-methyl-2-(methylamino)pyridine-3-carboxamide.
| Compound Name | N-(1-cyanopropan-2-yl)-5-fluoro-N-methyl-2-(methylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 114035010 |
| Molecular Formula | C12H15FN4O |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | N-(1-cyanopropan-2-yl)-5-fluoro-N-methyl-2-(methylamino)pyridine-3-carboxamide |
| SMILES | CNc1ncc(F)cc1C(=O)N(C)C(C)CC#N |
| InChI | InChI=1S/C12H15FN4O/c1-8(4-5-14)17(3)12(18)10-6-9(13)7-16-11(10)15-2/h6-8H,4H2,1-3H3,(H,15,16) |
| InChIKey | HSMQJDCADKPRBZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |