C12H13F2N3O — CID 55173776
4-amino-N-(1-cyanopropan-2-yl)-3,5-difluoro-N-methylbenzamide (PubChem CID 55173776) has the molecular formula C12H13F2N3O and a molecular weight of 253.25 g/mol. Its IUPAC name is 4-amino-N-(1-cyanopropan-2-yl)-3,5-difluoro-N-methylbenzamide.
| Compound Name | 4-amino-N-(1-cyanopropan-2-yl)-3,5-difluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 55173776 |
| Molecular Formula | C12H13F2N3O |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 4-amino-N-(1-cyanopropan-2-yl)-3,5-difluoro-N-methylbenzamide |
| SMILES | CC(CC#N)N(C)C(=O)c1cc(F)c(N)c(F)c1 |
| InChI | InChI=1S/C12H13F2N3O/c1-7(3-4-15)17(2)12(18)8-5-9(13)11(16)10(14)6-8/h5-7H,3,16H2,1-2H3 |
| InChIKey | DLRMTBLNUAKTFT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|