C15H22F2N2O — CID 63185021
4-amino-3,5-difluoro-N,N-bis(2-methylpropyl)benzamide (PubChem CID 63185021) has the molecular formula C15H22F2N2O and a molecular weight of 284.35 g/mol. Its IUPAC name is 4-amino-3,5-difluoro-N,N-bis(2-methylpropyl)benzamide.
| Compound Name | 4-amino-3,5-difluoro-N,N-bis(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 63185021 |
| Molecular Formula | C15H22F2N2O |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 4-amino-3,5-difluoro-N,N-bis(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)c1cc(F)c(N)c(F)c1 |
| InChI | InChI=1S/C15H22F2N2O/c1-9(2)7-19(8-10(3)4)15(20)11-5-12(16)14(18)13(17)6-11/h5-6,9-10H,7-8,18H2,1-4H3 |
| InChIKey | IXRTYVUVGZGRKH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|