C13H16BrClFNO3S — CID 65372257
2-bromo-5-[ethyl(2-methylpropyl)carbamoyl]-3-fluorobenzenesulfonyl chloride (PubChem CID 65372257) has the molecular formula C13H16BrClFNO3S and a molecular weight of 400.70 g/mol. Its IUPAC name is 2-bromo-5-[ethyl(2-methylpropyl)carbamoyl]-3-fluorobenzenesulfonyl chloride.
| Compound Name | 2-bromo-5-[ethyl(2-methylpropyl)carbamoyl]-3-fluorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 65372257 |
| Molecular Formula | C13H16BrClFNO3S |
| Molecular Weight | 400.70 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | 2-bromo-5-[ethyl(2-methylpropyl)carbamoyl]-3-fluorobenzenesulfonyl chloride |
| SMILES | CCN(CC(C)C)C(=O)c1cc(F)c(Br)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C13H16BrClFNO3S/c1-4-17(7-8(2)3)13(18)9-5-10(16)12(14)11(6-9)21(15,19)20/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | BLXMVAQXBJSBSU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.70 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |