C13H22FN3 — CID 114035397
3-(aminomethyl)-N-ethyl-5-fluoro-N-(2-methylbutyl)pyridin-2-amine (PubChem CID 114035397) has the molecular formula C13H22FN3 and a molecular weight of 239.34 g/mol. Its IUPAC name is 3-(aminomethyl)-N-ethyl-5-fluoro-N-(2-methylbutyl)pyridin-2-amine.
| Compound Name | 3-(aminomethyl)-N-ethyl-5-fluoro-N-(2-methylbutyl)pyridin-2-amine |
|---|---|
| PubChem CID | 114035397 |
| Molecular Formula | C13H22FN3 |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.18 |
| IUPAC Name | 3-(aminomethyl)-N-ethyl-5-fluoro-N-(2-methylbutyl)pyridin-2-amine |
| SMILES | CCC(C)CN(CC)c1ncc(F)cc1CN |
| InChI | InChI=1S/C13H22FN3/c1-4-10(3)9-17(5-2)13-11(7-15)6-12(14)8-16-13/h6,8,10H,4-5,7,9,15H2,1-3H3 |
| InChIKey | PJUCWOFJEYWPNS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |