C10H13F3N4O — CID 114035608
6-(propylamino)-N-(2,2,2-trifluoroethyl)pyrazine-2-carboxamide (PubChem CID 114035608) has the molecular formula C10H13F3N4O and a molecular weight of 262.23 g/mol. Its IUPAC name is 6-(propylamino)-N-(2,2,2-trifluoroethyl)pyrazine-2-carboxamide.
| Compound Name | 6-(propylamino)-N-(2,2,2-trifluoroethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 114035608 |
| Molecular Formula | C10H13F3N4O |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 6-(propylamino)-N-(2,2,2-trifluoroethyl)pyrazine-2-carboxamide |
| SMILES | CCCNc1cncc(C(=O)NCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N4O/c1-2-3-15-8-5-14-4-7(17-8)9(18)16-6-10(11,12)13/h4-5H,2-3,6H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | CHJJRVSCYRIPOI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |