C11H14N6O — CID 114036094
N-[1-(1H-imidazol-2-yl)ethyl]-6-(methylamino)pyrazine-2-carboxamide (PubChem CID 114036094) has the molecular formula C11H14N6O and a molecular weight of 246.27 g/mol. Its IUPAC name is N-[1-(1H-imidazol-2-yl)ethyl]-6-(methylamino)pyrazine-2-carboxamide.
| Compound Name | N-[1-(1H-imidazol-2-yl)ethyl]-6-(methylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 114036094 |
| Molecular Formula | C11H14N6O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-[1-(1H-imidazol-2-yl)ethyl]-6-(methylamino)pyrazine-2-carboxamide |
| SMILES | CNc1cncc(C(=O)NC(C)c2ncc[nH]2)n1 |
| InChI | InChI=1S/C11H14N6O/c1-7(10-14-3-4-15-10)16-11(18)8-5-13-6-9(12-2)17-8/h3-7H,1-2H3,(H,12,17)(H,14,15)(H,16,18) |
| InChIKey | BPKIIAKLELHJRT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |