C11H17N5O2 — CID 114176591
N-(1-amino-3-methyl-1-oxobutan-2-yl)-6-(methylamino)pyrazine-2-carboxamide (PubChem CID 114176591) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is N-(1-amino-3-methyl-1-oxobutan-2-yl)-6-(methylamino)pyrazine-2-carboxamide.
| Compound Name | N-(1-amino-3-methyl-1-oxobutan-2-yl)-6-(methylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 114176591 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | N-(1-amino-3-methyl-1-oxobutan-2-yl)-6-(methylamino)pyrazine-2-carboxamide |
| SMILES | CNc1cncc(C(=O)NC(C(N)=O)C(C)C)n1 |
| InChI | InChI=1S/C11H17N5O2/c1-6(2)9(10(12)17)16-11(18)7-4-14-5-8(13-3)15-7/h4-6,9H,1-3H3,(H2,12,17)(H,13,15)(H,16,18) |
| InChIKey | PFFUSIVZXZWTKL-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |