C10H14N8O — CID 114036218
6-hydrazinyl-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrazine-2-carboxamide (PubChem CID 114036218) has the molecular formula C10H14N8O and a molecular weight of 262.28 g/mol. Its IUPAC name is 6-hydrazinyl-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrazine-2-carboxamide.
| Compound Name | 6-hydrazinyl-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 114036218 |
| Molecular Formula | C10H14N8O |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 6-hydrazinyl-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrazine-2-carboxamide |
| SMILES | CC(NC(=O)c1cncc(NN)n1)c1nncn1C |
| InChI | InChI=1S/C10H14N8O/c1-6(9-17-13-5-18(9)2)14-10(19)7-3-12-4-8(15-7)16-11/h3-6H,11H2,1-2H3,(H,14,19)(H,15,16) |
| InChIKey | JJUCFFXIOCMKRU-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 123.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|