C6H11N5S — CID 62116971
1-(4-methyl-1,2,4-triazol-3-yl)ethylthiourea (PubChem CID 62116971) has the molecular formula C6H11N5S and a molecular weight of 185.26 g/mol. Its IUPAC name is 1-(4-methyl-1,2,4-triazol-3-yl)ethylthiourea.
| Compound Name | 1-(4-methyl-1,2,4-triazol-3-yl)ethylthiourea |
|---|---|
| PubChem CID | 62116971 |
| Molecular Formula | C6H11N5S |
| Molecular Weight | 185.26 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 1-(4-methyl-1,2,4-triazol-3-yl)ethylthiourea |
| SMILES | CC(NC(N)=S)c1nncn1C |
| InChI | InChI=1S/C6H11N5S/c1-4(9-6(7)12)5-10-8-3-11(5)2/h3-4H,1-2H3,(H3,7,9,12) |
| InChIKey | UECDHGZWGCMREJ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|