About 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]ethanol
2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]ethanol (PubChem CID 55211655) has the molecular formula C7H14N4O
and a molecular weight of 170.22 g/mol. Its IUPAC name is 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]ethanol.
Analyze 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]ethanol?
The IUPAC name of 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]ethanol (CID 55211655) is 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]ethanol.
What is the SMILES notation for 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]ethanol?
The canonical SMILES for 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]ethanol is CC(NCCO)c1nncn1C.
What is the InChIKey of 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]ethanol?
The InChIKey is DXZCWEDBKMGGAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4O/c1-6(8-3-4-12)7-10-9-5-11(7)2/h5-6,8,12H,3-4H2,1-2H3.
What are the key properties of 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]ethanol?
2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]ethanol has a molecular weight of 170.22 g/mol, XLogP of -0.54, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]ethanol is sourced from PubChem (CID 55211655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).