C8H13N5 — CID 62117721
3-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]propanenitrile (PubChem CID 62117721) has the molecular formula C8H13N5 and a molecular weight of 179.23 g/mol. Its IUPAC name is 3-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]propanenitrile.
| Compound Name | 3-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]propanenitrile |
|---|---|
| PubChem CID | 62117721 |
| Molecular Formula | C8H13N5 |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | 3-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]propanenitrile |
| SMILES | CC(NCCC#N)c1nncn1C |
| InChI | InChI=1S/C8H13N5/c1-7(10-5-3-4-9)8-12-11-6-13(8)2/h6-7,10H,3,5H2,1-2H3 |
| InChIKey | YNMHDERWIAYSBI-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|