C9H16N6 — CID 62364865
2-cyclopropyl-1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]guanidine (PubChem CID 62364865) has the molecular formula C9H16N6 and a molecular weight of 208.27 g/mol. Its IUPAC name is 2-cyclopropyl-1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]guanidine.
| Compound Name | 2-cyclopropyl-1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 62364865 |
| Molecular Formula | C9H16N6 |
| Molecular Weight | 208.27 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 2-cyclopropyl-1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]guanidine |
| SMILES | CC(N/C(N)=N/C1CC1)c1nncn1C |
| InChI | InChI=1S/C9H16N6/c1-6(8-14-11-5-15(8)2)12-9(10)13-7-3-4-7/h5-7H,3-4H2,1-2H3,(H3,10,12,13) |
| InChIKey | WRERRPMUBMVMRU-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.27 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|