C12H19N5O2S — CID 62116994
4-carbamothioyl-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]oxane-4-carboxamide (PubChem CID 62116994) has the molecular formula C12H19N5O2S and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-carbamothioyl-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]oxane-4-carboxamide.
| Compound Name | 4-carbamothioyl-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 62116994 |
| Molecular Formula | C12H19N5O2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 4-carbamothioyl-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]oxane-4-carboxamide |
| SMILES | CC(NC(=O)C1(C(N)=S)CCOCC1)c1nncn1C |
| InChI | InChI=1S/C12H19N5O2S/c1-8(9-16-14-7-17(9)2)15-11(18)12(10(13)20)3-5-19-6-4-12/h7-8H,3-6H2,1-2H3,(H2,13,20)(H,15,18) |
| InChIKey | KXZIULLDWTZBRA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|