C12H15N5S — CID 55038202
4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]benzenecarbothioamide (PubChem CID 55038202) has the molecular formula C12H15N5S and a molecular weight of 261.35 g/mol. Its IUPAC name is 4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]benzenecarbothioamide.
| Compound Name | 4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 55038202 |
| Molecular Formula | C12H15N5S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]benzenecarbothioamide |
| SMILES | CC(Nc1ccc(C(N)=S)cc1)c1nncn1C |
| InChI | InChI=1S/C12H15N5S/c1-8(12-16-14-7-17(12)2)15-10-5-3-9(4-6-10)11(13)18/h3-8,15H,1-2H3,(H2,13,18) |
| InChIKey | OPCCJPKGMZAENY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|