C13H18N6O — CID 77029668
N'-hydroxy-4-[[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]benzenecarboximidamide (PubChem CID 77029668) has the molecular formula C13H18N6O and a molecular weight of 274.33 g/mol. Its IUPAC name is N'-hydroxy-4-[[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 77029668 |
| Molecular Formula | C13H18N6O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | N'-hydroxy-4-[[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]benzenecarboximidamide |
| SMILES | CC(NCc1ccc(C(N)=NO)cc1)c1nncn1C |
| InChI | InChI=1S/C13H18N6O/c1-9(13-17-16-8-19(13)2)15-7-10-3-5-11(6-4-10)12(14)18-20/h3-6,8-9,15,20H,7H2,1-2H3,(H2,14,18) |
| InChIKey | WHCQLDIMANQDMZ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|