C11H14ClN7O — CID 62238242
2-chloro-6-hydrazinyl-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyridine-4-carboxamide (PubChem CID 62238242) has the molecular formula C11H14ClN7O and a molecular weight of 295.73 g/mol. Its IUPAC name is 2-chloro-6-hydrazinyl-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-6-hydrazinyl-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62238242 |
| Molecular Formula | C11H14ClN7O |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-chloro-6-hydrazinyl-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyridine-4-carboxamide |
| SMILES | CC(NC(=O)c1cc(Cl)nc(NN)c1)c1nncn1C |
| InChI | InChI=1S/C11H14ClN7O/c1-6(10-18-14-5-19(10)2)15-11(20)7-3-8(12)16-9(4-7)17-13/h3-6H,13H2,1-2H3,(H,15,20)(H,16,17) |
| InChIKey | JIZDZERUAPLLNH-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|