C11H9ClFN5O — CID 114036263
N-(3-chloro-4-fluorophenyl)-6-hydrazinylpyrazine-2-carboxamide (PubChem CID 114036263) has the molecular formula C11H9ClFN5O and a molecular weight of 281.68 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-6-hydrazinylpyrazine-2-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-6-hydrazinylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 114036263 |
| Molecular Formula | C11H9ClFN5O |
| Molecular Weight | 281.68 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-6-hydrazinylpyrazine-2-carboxamide |
| SMILES | NNc1cncc(C(=O)Nc2ccc(F)c(Cl)c2)n1 |
| InChI | InChI=1S/C11H9ClFN5O/c12-7-3-6(1-2-8(7)13)16-11(19)9-4-15-5-10(17-9)18-14/h1-5H,14H2,(H,16,19)(H,17,18) |
| InChIKey | DWDTUELBTIWUBJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.68 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|