C11H8F3N5O — CID 114036287
6-hydrazinyl-N-(3,4,5-trifluorophenyl)pyrazine-2-carboxamide (PubChem CID 114036287) has the molecular formula C11H8F3N5O and a molecular weight of 283.21 g/mol. Its IUPAC name is 6-hydrazinyl-N-(3,4,5-trifluorophenyl)pyrazine-2-carboxamide.
| Compound Name | 6-hydrazinyl-N-(3,4,5-trifluorophenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 114036287 |
| Molecular Formula | C11H8F3N5O |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 6-hydrazinyl-N-(3,4,5-trifluorophenyl)pyrazine-2-carboxamide |
| SMILES | NNc1cncc(C(=O)Nc2cc(F)c(F)c(F)c2)n1 |
| InChI | InChI=1S/C11H8F3N5O/c12-6-1-5(2-7(13)10(6)14)17-11(20)8-3-16-4-9(18-8)19-15/h1-4H,15H2,(H,17,20)(H,18,19) |
| InChIKey | IXBBNBIZQJYBJM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|