C11H10Cl2N2O4 — CID 114036820
(2R,4R)-1-(2,6-dichloropyridine-3-carbonyl)-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 114036820) has the molecular formula C11H10Cl2N2O4 and a molecular weight of 305.12 g/mol. Its IUPAC name is (2R,4R)-1-(2,6-dichloropyridine-3-carbonyl)-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4R)-1-(2,6-dichloropyridine-3-carbonyl)-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 114036820 |
| Molecular Formula | C11H10Cl2N2O4 |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | (2R,4R)-1-(2,6-dichloropyridine-3-carbonyl)-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@@H](O)CN1C(=O)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C11H10Cl2N2O4/c12-8-2-1-6(9(13)14-8)10(17)15-4-5(16)3-7(15)11(18)19/h1-2,5,7,16H,3-4H2,(H,18,19)/t5-,7-/m1/s1 |
| InChIKey | GRIGDKLSMARZOU-IYSWYEEDSA-N |
| XLogP | 1.05 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|