C11H11ClN2O4 — CID 64714061
(2S,4S)-1-(6-chloropyridine-2-carbonyl)-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 64714061) has the molecular formula C11H11ClN2O4 and a molecular weight of 270.67 g/mol. Its IUPAC name is (2S,4S)-1-(6-chloropyridine-2-carbonyl)-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-1-(6-chloropyridine-2-carbonyl)-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 64714061 |
| Molecular Formula | C11H11ClN2O4 |
| Molecular Weight | 270.67 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | (2S,4S)-1-(6-chloropyridine-2-carbonyl)-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H](O)CN1C(=O)c1cccc(Cl)n1 |
| InChI | InChI=1S/C11H11ClN2O4/c12-9-3-1-2-7(13-9)10(16)14-5-6(15)4-8(14)11(17)18/h1-3,6,8,15H,4-5H2,(H,17,18)/t6-,8-/m0/s1 |
| InChIKey | RXBHHIZIKOXDLD-XPUUQOCRSA-N |
| XLogP | 0.40 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.67 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|