C12H14N2O4 — CID 114040167
1-[3-(cyclopropylamino)-3-oxopropyl]-6-oxopyridine-2-carboxylic acid (PubChem CID 114040167) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 1-[3-(cyclopropylamino)-3-oxopropyl]-6-oxopyridine-2-carboxylic acid.
| Compound Name | 1-[3-(cyclopropylamino)-3-oxopropyl]-6-oxopyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 114040167 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 1-[3-(cyclopropylamino)-3-oxopropyl]-6-oxopyridine-2-carboxylic acid |
| SMILES | O=C(CCn1c(C(=O)O)cccc1=O)NC1CC1 |
| InChI | InChI=1S/C12H14N2O4/c15-10(13-8-4-5-8)6-7-14-9(12(17)18)2-1-3-11(14)16/h1-3,8H,4-7H2,(H,13,15)(H,17,18) |
| InChIKey | OBZPCKHSIVOBCI-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |