C12H24N2O3 — CID 114042000
N-ethyl-N-(2-hydroxyethyl)-4-(methoxymethyl)piperidine-4-carboxamide (PubChem CID 114042000) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is N-ethyl-N-(2-hydroxyethyl)-4-(methoxymethyl)piperidine-4-carboxamide.
| Compound Name | N-ethyl-N-(2-hydroxyethyl)-4-(methoxymethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 114042000 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | N-ethyl-N-(2-hydroxyethyl)-4-(methoxymethyl)piperidine-4-carboxamide |
| SMILES | CCN(CCO)C(=O)C1(COC)CCNCC1 |
| InChI | InChI=1S/C12H24N2O3/c1-3-14(8-9-15)11(16)12(10-17-2)4-6-13-7-5-12/h13,15H,3-10H2,1-2H3 |
| InChIKey | MDNYDYZMHQWAMH-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |