C13H23N3O — CID 63128833
N-(2-cyanoethyl)-N,4-diethylpiperidine-4-carboxamide (PubChem CID 63128833) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N,4-diethylpiperidine-4-carboxamide.
| Compound Name | N-(2-cyanoethyl)-N,4-diethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 63128833 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | N-(2-cyanoethyl)-N,4-diethylpiperidine-4-carboxamide |
| SMILES | CCN(CCC#N)C(=O)C1(CC)CCNCC1 |
| InChI | InChI=1S/C13H23N3O/c1-3-13(6-9-15-10-7-13)12(17)16(4-2)11-5-8-14/h15H,3-7,9-11H2,1-2H3 |
| InChIKey | IMWSAUFBASDHBX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |