C13H26N2O2 — CID 63692883
N-(2-ethoxyethyl)-N,3-diethylpyrrolidine-3-carboxamide (PubChem CID 63692883) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-N,3-diethylpyrrolidine-3-carboxamide.
| Compound Name | N-(2-ethoxyethyl)-N,3-diethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 63692883 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | N-(2-ethoxyethyl)-N,3-diethylpyrrolidine-3-carboxamide |
| SMILES | CCOCCN(CC)C(=O)C1(CC)CCNC1 |
| InChI | InChI=1S/C13H26N2O2/c1-4-13(7-8-14-11-13)12(16)15(5-2)9-10-17-6-3/h14H,4-11H2,1-3H3 |
| InChIKey | KUOCJGHBHGGCKM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|