C16H32N2O3 — CID 82960199
N,N-bis(2-ethoxyethyl)-4-ethylpiperidine-4-carboxamide (PubChem CID 82960199) has the molecular formula C16H32N2O3 and a molecular weight of 300.44 g/mol. Its IUPAC name is N,N-bis(2-ethoxyethyl)-4-ethylpiperidine-4-carboxamide.
| Compound Name | N,N-bis(2-ethoxyethyl)-4-ethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 82960199 |
| Molecular Formula | C16H32N2O3 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.24 |
| IUPAC Name | N,N-bis(2-ethoxyethyl)-4-ethylpiperidine-4-carboxamide |
| SMILES | CCOCCN(CCOCC)C(=O)C1(CC)CCNCC1 |
| InChI | InChI=1S/C16H32N2O3/c1-4-16(7-9-17-10-8-16)15(19)18(11-13-20-5-2)12-14-21-6-3/h17H,4-14H2,1-3H3 |
| InChIKey | SYTQRZGLUFHKDO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|