C13H20N4O — CID 63127318
N,N-bis(cyanomethyl)-4-propylpiperidine-4-carboxamide (PubChem CID 63127318) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-4-propylpiperidine-4-carboxamide.
| Compound Name | N,N-bis(cyanomethyl)-4-propylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 63127318 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | N,N-bis(cyanomethyl)-4-propylpiperidine-4-carboxamide |
| SMILES | CCCC1(C(=O)N(CC#N)CC#N)CCNCC1 |
| InChI | InChI=1S/C13H20N4O/c1-2-3-13(4-8-16-9-5-13)12(18)17(10-6-14)11-7-15/h16H,2-5,8-11H2,1H3 |
| InChIKey | TZNMUYRNGAZQRT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|