C11H17FN4S — CID 114045573
3-[(6-ethyl-5-fluoropyrimidin-4-yl)-methylamino]butanethioamide (PubChem CID 114045573) has the molecular formula C11H17FN4S and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-[(6-ethyl-5-fluoropyrimidin-4-yl)-methylamino]butanethioamide.
| Compound Name | 3-[(6-ethyl-5-fluoropyrimidin-4-yl)-methylamino]butanethioamide |
|---|---|
| PubChem CID | 114045573 |
| Molecular Formula | C11H17FN4S |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3-[(6-ethyl-5-fluoropyrimidin-4-yl)-methylamino]butanethioamide |
| SMILES | CCc1ncnc(N(C)C(C)CC(N)=S)c1F |
| InChI | InChI=1S/C11H17FN4S/c1-4-8-10(12)11(15-6-14-8)16(3)7(2)5-9(13)17/h6-7H,4-5H2,1-3H3,(H2,13,17) |
| InChIKey | CFFLRRMCDQQVIP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|