C9H16N4S2 — CID 65272274
3-[(3-ethyl-1,2,4-thiadiazol-5-yl)-methylamino]butanethioamide (PubChem CID 65272274) has the molecular formula C9H16N4S2 and a molecular weight of 244.39 g/mol. Its IUPAC name is 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)-methylamino]butanethioamide.
| Compound Name | 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)-methylamino]butanethioamide |
|---|---|
| PubChem CID | 65272274 |
| Molecular Formula | C9H16N4S2 |
| Molecular Weight | 244.39 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)-methylamino]butanethioamide |
| SMILES | CCc1nsc(N(C)C(C)CC(N)=S)n1 |
| InChI | InChI=1S/C9H16N4S2/c1-4-8-11-9(15-12-8)13(3)6(2)5-7(10)14/h6H,4-5H2,1-3H3,(H2,10,14) |
| InChIKey | HYIBEUSCCFYUHZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|