C12H20FN3O — CID 114045642
6-ethyl-5-fluoro-N-(3-propoxypropyl)pyrimidin-4-amine (PubChem CID 114045642) has the molecular formula C12H20FN3O and a molecular weight of 241.31 g/mol. Its IUPAC name is 6-ethyl-5-fluoro-N-(3-propoxypropyl)pyrimidin-4-amine.
| Compound Name | 6-ethyl-5-fluoro-N-(3-propoxypropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114045642 |
| Molecular Formula | C12H20FN3O |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 6-ethyl-5-fluoro-N-(3-propoxypropyl)pyrimidin-4-amine |
| SMILES | CCCOCCCNc1ncnc(CC)c1F |
| InChI | InChI=1S/C12H20FN3O/c1-3-7-17-8-5-6-14-12-11(13)10(4-2)15-9-16-12/h9H,3-8H2,1-2H3,(H,14,15,16) |
| InChIKey | IMHKDJYQGVTAAK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|