C12H21FN4 — CID 113344333
N-(6-ethyl-5-fluoropyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine (PubChem CID 113344333) has the molecular formula C12H21FN4 and a molecular weight of 240.33 g/mol. Its IUPAC name is N-(6-ethyl-5-fluoropyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine.
| Compound Name | N-(6-ethyl-5-fluoropyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 113344333 |
| Molecular Formula | C12H21FN4 |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | N-(6-ethyl-5-fluoropyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine |
| SMILES | CCc1ncnc(NCCCCN(C)C)c1F |
| InChI | InChI=1S/C12H21FN4/c1-4-10-11(13)12(16-9-15-10)14-7-5-6-8-17(2)3/h9H,4-8H2,1-3H3,(H,14,15,16) |
| InChIKey | VFKIMFOIVGKCGK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|